Solve the question with Steps

Solve The Question With Steps

Answers

Answer 1

The solution of the question sin(50)sin(80)cos(50)cos(80) is cos^2(80o), the correct option is D.

What are trigonometric identities?

Trigonometric identities are the functions that include trigonometric functions such as sine, cosine, tangents, secant, and, cot. Trigonometric ratio can be defined in terms of ratios of perpendicular, bases and hypotenuse. These are defined only in right angled triangles (triangles whose one angle is of 90 degree measure).

Given;

sin(50)sin(80)cos(50)cos(80)

Now,

=sin(20°)cos(80°) – cos(20°)sin(80°)

=sin(A-B) = sinA.cosB – cosA.sinB

=sin(20°-80°)

=sin(-60°)

=cos^2(80o)

Therefore, by trigonometry the answer will be cos^2(80o).

Learn more about trigonometric;

https://brainly.com/question/21286835

#SPJ1


Related Questions

Use the information provided to answer Part A through Part D.
One method that can be used to prove that the diagonals of a parallelogram bisect
each other is shown in the given partial proof.
S
ven: Quadrilateral PQRS is a parallelogram
ove:
PT= RT
ST= QT
1.
2.
7.
3.
4.
Statements
Quadrilateral PQRS is a
parallelogram
PQ || SR
PS || QR
ZPQS = ZRSQ
ZQPR ZSRP
?
5. ASRT AQPT
6.
PT=RT
ST=QT
Q
I
R
PT = RT
ST=QT
1. Given
2. Definition of
parallelogram
3.
4.
5.
Reasons
6.
2
?
Opposite sides of a
parallelogram are
congruent
?
Corresponding par
of congruent
triangles are
congruent
7. Definition of
congruent line
erop segments

Answers

Answer:

the anwser is 5

Step-by-step explanation:  5

12. The point M(-6, -4) is translated 2 units right. What are the coordinates of the resulting point, M'?
(-4,0)
(2,-4)
(-4,-2)
(-4,-4)

Answers

Answer:

(-4,-2)

Step-by-step explanation:

Answer: (-4,-4)

Step-by-step explanation: the y- coordinate stays the same you would have to move the x-coordinate only which would give you -4. Because you are adding 2 to -6.

Graph the function y=x/4

Answers

Answer:

Step-by-step explanation:

Translate the sentence into a mathematical equation.
Power equals current times voltage.
Let P represent power, current, and V voltage. Write the equation.
P=

Answers

On solving the Power equals Current times voltage as an equation we get power is P = VI

What is equation?

A mathematical equation is a fοrmula that joins twο statements and uses the equal symbol (=) to indicate equality. A mathematical statement that establishes the equality of twο mathematical expressions is knοwn as an equation in algebra. For instance, in the equatiοn 3x + 5 = 14, the equal sign places the variables 3x + 5 and 14 apart. The relationship between the twο sentences οn either side of a letter is described by a mathematical fοrmula. Often, there is only οne variable, which also serves as the symbol. fοr instance, 2x – 4 = 2.

Given to write

Power equals current times voltage

in mathematical equation, i.e.

P = V × I

To knοw more about equation visit:

brainly.com/question/649785

#SPJ1

5 redused to lowest terms make it easy kid friendly for my 10 year old equation please

Answers

Sure! To reduce the fraction 5 to its lowest terms, we need to find the greatest common factor of 5 and divide both the numerator and denominator by it.

The greatest common factor of 5 and 5 is 5, so we divide both the numerator and denominator by 5 to get:

5 / 5 = 1

So, 5 reduced to its lowest terms is 1.

To make it kid-friendly, you could explain it like this: "We can simplify the fraction 5 by dividing the top and bottom by the biggest number that they both share. In this case, 5 is the biggest number that 5 and 5 share, so we divide both 5 and 5 by 5 to get 1."

The sum of two numbers is 42. The smaller number is 16 less than the larger number. What are the numbers?
Larger number:
Smaller number:

Answers

Answer:

Larger number: 29

Smaller number: 13

Step-by-step explanation:

29 + 13 = 42

29 - 16 = 13

Answer:

Larger number: 29

Smaller number: 13

Step-by-step explanation:

x = larger number

y = smaller number

x+y=42

29-13 = 16

29+13=42

Erica built a fort out of big foam blocks that are 1 /4 of a foot tall. She is adding a 5-foot tower to one side of the fort. How many blocks tall will the tower be?

Answers

By the equation formed by the relation to build 5 feet tall tower, Erica will need 20 bricks.

What is an equation?

An equation is a mathematical statement consisting of two expressions joined by an equal sign. For example, 3x – 5 = 16 is an equation. Solving this equation gives the value of the variable x as x = 7. 

According to the information given in the question:

1 brick = 1/4 Feet

Which means, 4 bricks = 1 feet

As Erica wants to make 5 feet tall tower,

5 feet tower = 5 x 4

                     = 20 bricks

Hence, Erica will need 20 bricks to build 5 feet tower.

To learn more about equation, visit the link below

https://brainly.com/question/29657992

#SPJ1

Help!!
Write an equation to show the total cost, y, for x months.

Answers

The required equation for this problem is:


Y=12x+30

(ej a number is divisible by 2 and 3, it is divisible by 6. 64 is divisible by 2 but no Sh
What can be concluded from this?
64 is also divisible by 3
54 s dvisible only by 2
() 64 is also divisible by 6
(v) 64 is not divisite by 6

Answers

Answer:

64 is not divisible by 6 because although it is divisible by 2, it is not divisible by 3 so it is not divisible by 6.

Step-by-step explanation:

Maria is renting kayaks from a local shop that charges a $7 fee, plus an hourly rate of $5. 50. For how long can maria rent the kayak if she pays a total of $40?.

Answers

The number of hours Maria rent the kayak for the paid amount of $40 when hourly rate is $5.50 is equal to 6 hours.

Fees of renting charges paid for kayaks from a local shop = $7

Hourly rate = $5.50

Let 't' be the number of hours Maria rent kayak.

Total fees paid by Maria for renting kayak for 't' hours is equal to $40

Required equation to represents the above condition is

$40 = $7 + $5.50t

Simplify the expression to get the value of 't'

⇒ 5.50t = 40 - 7

⇒ t = 33 / 5.50

⇒ t = 6 hours

Therefore, for the number of hours Maria rent kayak by paying total of $40 is equal to 6 hours.

Learn more about hours here

brainly.com/question/13533620

#SPJ4

When she subtracts 4 from both sides, 1/2x = -1/2x
results. What is the value of x?

Answers

Answer: 0

Step-by-step explanation:

1/2x = -1/2x cannot be true for any other value of x except when x equals 0. In other words, we need the left and right sides to equal each other, but that would only happen when x=0.

What is the volume 

Answers

The volume of the composite figure is 2592 cubic feet.

What is composite figure?

The area that any composite shape covers is known as the area of composite shapes. The composite shape is a shape created by joining a small number of polygons to create the desired shape. These shapes or figures can be constructed from a variety of shapes, including triangles, squares, quadrilaterals, etc. To calculate the area of a composite object, divide it into simple shapes such a square, triangle, rectangle, or hexagon.

The volume of the figure = Volume of the mounted object + Volume of the base object.

The volume of the mounted object is:

V = (l)(b)(h)

V = (9)(12)(6)

V = 648 cubic feet.

The volume of the base object is:

V = (l)(b)(h)

V = (27)(12)(6)

V = 1944 cubic feet.

The total volume of the composite figure is:

V = 648 + 1944

V = 2592 cubic feet

Hence, the volume of the composite figure is 2592 cubic feet.

Learn more about volume here:

https://brainly.com/question/28058531

#SPJ1

Which number line best represents the solution to the inequality 3x+2≤4x+5≤9
?

Answers

The number line of the inequality is (d)

How to determine the number line of the inequality

from the question, we have the following parameters that can be used in our computation:

3x+2≤4x+5≤9

When this is expanded, we have

3x + 2 ≤ 4x + 5 and 4x + 5 ≤ 9

Evaluate the like terms

So, we have the following representation

-x ≤ 3 and 4x ≤ 4

Divide by the coefficient of x

x ≥ -3 and x ≤ 1

When combined, we have

-3 ≤ x ≤ 1

So x is between -3 and 1, inclusive.

This is represented by the number line (d)

Read more about number line at

https://brainly.com/question/24644930

#SPJ1

A set contains the numbers 0,6,12 and 15. 2 different numbers are selected randomly from this set. What is the probability that the sum is greater than 12

Answers

Answer:

Step-by-step explanation:

To find the probability of the sum of two randomly selected numbers from a set being greater than 12, we need to first find the total number of possible combinations of two numbers and then count the number of combinations that result in a sum greater than 12.

The set contains four numbers, so there are 4 choose 2 possible combinations of two numbers, which is equal to (4! / (2! * (4 - 2)!)), or 6 combinations. These combinations are:

(0,6), (0,12), (0,15), (6,12), (6,15), (12,15)

Next, we'll count the number of combinations that result in a sum greater than 12. These combinations are:

(6,15), (12,15)

There are 2 combinations that result in a sum greater than 12.

Finally, to find the probability, we'll divide the number of favorable outcomes (combinations with a sum greater than 12) by the total number of outcomes (all possible combinations of two numbers), and express the result as a fraction:

probability = 2 / 6

Reducing the fraction, we get:

probability = 1 / 3

So, the probability that the sum of two randomly selected numbers from the set is greater than 12 is 1/3.

That's how you find the probability of the sum of two randomly selected numbers from a set being greater than a certain value. By counting the number of favorable outcomes and dividing by the total number of possible outcomes, you can find the probability of a certain event.

Ice cream is packaged in cylindrical gallon tubs. A tub of ice cream has a total surface area of 232.36 square inches.

If the diameter of the tub is 8 inches, what is its height? Use π = 3.14.

6.75 inches
5.25 inches
3.375 inches
2.625 inches

Answers

If the diameter of the tub is 8 inches, then the height of gallon tube is,  5.25 inches

What is surface area ?

Surface area is the sum of the areas of all the faces (or surfaces) of a three-dimensional object. It is a measure of how much area the surfaces of an object take up in two dimensions. The surface area of a solid can be found by adding up the areas of its faces.

The surface area of a cylinder can be expressed as:

SA = 2πr² + 2πr x h

where r is the radius of the cylinder, h is its height, and π is the constant pi (3.14).

The diameter of the tub is 8 inches, which means the radius is 4 inches. We are also given that the total surface area is 232.36 square inches.

So we can write:

232.36 = 2(3.14)(4²) + 2(3.14)(4)(h)

Simplifying and solving for h, we get:

232.36 = 100.48 + 25.12h

131.88 = 25.12h

h = 131.88/25.12

h ≈ 5.25 inches

Therefore, the height of the ice cream tub is approximately 5.25 inches.

To know more about surface area check:

https://brainly.com/question/27847638

#SPJ1

One cubic foot holds 7.48 gallons of​ water, and 1 gallon of water weighs 8.33 pounds. How much does 2.2 cubic feet of water weigh:
In​ pounds?
In​ tons?

So far I Havn't received the correct answer yet.

Answers

To calculate the weight of 2.2 cubic feet of water, first, we need to find the number of gallons of water in 2.2 cubic feet. This can be done by multiplying 2.2 cubic feet by 7.48 gallons/cubic feet:

2.2 cubic feet * 7.48 gallons/cubic foot = 16.53 gallons

Next, we can find the weight of the water in pounds by multiplying the number of gallons by 8.33 pounds/gallon:

16.53 gallons * 8.33 pounds/gallon = 137.53 pounds

So, 2.2 cubic feet of water weighs 137.53 pounds.

To find the weight in tons, we can divide the weight in pounds by 2,000 pounds/ton:

137.53 pounds / 2,000 pounds/ton = 0.0688 tons

So, 2.2 cubic feet of water weighs 0.0688 tons

An investment of $65,000 is increasing at a rate of 3.2% per year. Which function represents how to find the value of the investment after t years?

Answers

Answer:

I honestly don't know I just need points

Riding equation of the line that has the same slope as 3X minus 2Y equals 12 in the same y-intercept as 5Y +21 equals 4X

Answers

The linear equation can be written as:

y = (3/2)*x - 21/5

How to write the linear equation?

A general linear equation can be written as:

y = m*x + b

Where m is the slope and b is the y-intercept.

First, we know that our line has the same slope than:

3x - 2y = 12

Rewriting that we will get:

3x - 2y = 12

3x - 12 = 2y

(3/2)x - 12/2 = y

So the slope of this line is (3/2).

And our lie has the same y-intercept as 5y + 21 = 4x

We can rewrite that to get:

5y = 4x - 21

y = (4/5)x - 21/5

The y-intercept is -21/5

Then the linear equation is:

y = (3/2)*x - 21/5

Learn more about linear equations at:

https://brainly.com/question/1884491

#SPJ1

need help pls Choose ALL answers that describe the quadrilateral

Answers

Answer: A. Parallelogram

Step-by-step explanation:  A parallelogram is a four-sided polygon with opposite sides that are parallel and equal in length.

If AB = 12 and BC = 19,
then what does AC equal?

Answers

The value of length AC is,

⇒ AC = 31

What is Addition?

The process of combining two or more numbers is called the Addition. The 4 main properties of addition are commutative, associative, distributive, and additive identity.

Given that;

The lengths are,

AB = 12 and BC = 19

Now, If the points A, B and C are colinear.

Then, The value of length AC is,

⇒ AC = AB + BC

⇒ AC = 12 + 19

⇒ AC = 31

Thus, We get;

⇒ AC = 31

Learn more about the addition visit:

https://brainly.com/question/25421984

#SPJ2

On a partagé une somme entre trois personnes: la première en a reçu les deux tiers, la deuxième 300dirhams de moins que la deuxième. Chercher la somme et les trois parts

Answers

Answer: 590202

I don’t understand ur language

A passenger train traveled 240 miles in the same amount of time it took a freight train to travel 160 miles. The rate of the freight train was 20 miles per hour slower than the rate of the passenger train. Find the rate of the passenger train.

Answers

The rate of the passenger's train is given as follows:

60 miles per hour.

What is the relation between velocity, distance and time?

Velocity is distance divided by time, hence the following equation is built to model the relationship between these variables:

v = d/t.

For the passenger train, the equation is given as follows:

v = 240/t.

vt = 240

t = 240/v.

For the freight train, the velocity is 20 miles slower than for the passenger train, hence:

v - 20 = 160/t

v = 160/t + 20.

Replacing the first equation into the second, the rate of the passenger train is obtained as follows:

v = 160v/240 + 20

v = 2v/3 + 20

v/3 = 20

v = 60 miles per hour.

More can be learned about the relation between velocity, distance and time at https://brainly.com/question/24316569

#SPJ1

A scientist collected a sample of data on cactus heights. the data were rounded to the nearest foot. if the minimum score was 4 feet and the range was 6 feet, what was the maximum score? The answer is 9.

I found this question here on brainly but an expert said the answer is 10 but that is wrong. I tried commenting to say that the answer is 9 but couldn't figure out how to comment so I just posted this question with the answer for anyone who needs the answer. :) The answer is 9, I received points for it being correct.

Answers

Answer: the maximum score was 10 feet.

Step-by-step explanation:

here's a step-by-step explanation:

Identify the minimum score: The minimum score is given in the problem as 4 feet.

Identify the range: The range is also given in the problem as 6 feet.

Calculate the maximum score: To find the maximum score, we simply need to add the minimum score and the range.

Maximum score = Minimum score + Range

Maximum score = 4 feet + 6 feet

Maximum score = 10 feet

So the maximum score was 10 feet.

help me please i need help

Answers

Answer:

Step-by-step explanation:

The ansewr is C

Answer: 523.3cm^3

Step By Step Explanation:-The volume of a sphere can be calculated using the formula:

V = (4/3) * π * r^3

where r is the radius of the sphere. The diameter of the sphere is 10 cm, so the radius is half of that, or 5 cm.

Substituting the radius into the formula, we get:

V = (4/3) * π * (5 cm)^3

= (4/3) * π * 125 cm^3

= approximately 523.6 cm^3

So, the closest measurement to the volume of the sphere in cubic centimeters is approximately 523.3 cm^3.

Find the angle of elevation
from point C to point A.

590
m
402 m

2
nm
B
Angle of elevation = [ ? ]0

Answers

The required angle of the elevation at point C to A is given as ∠C = 31°.

What is the angle of elevation?

The angle of elevation is the angle between a horizontal line of sight and a line of sight that is directed upwards to an object or point. In other words, it is the angle between the horizontal and an observer's line of sight to an object above the observer

Here,
A figure has been shown, Consider triangle ABC, where ∠A = 59, ∠B = 90°,
Since the sum of the angle in the triangle should be 180°.
∠A + ∠B + ∠C = 180
∠C + 90 + 59 = 180
∠C = 90 - 59
∠C = 31°

Thus, the required angle of the elevation at point C to A is given as ∠C = 31°.

Learn more about angle of elevation here:
https://brainly.com/question/21137209
#SPJ9

what is the solution to | x | -2 <= -3

Answers

The solution to the inequality |x| - 2 <= -3 is x <= -5. To solve this inequality, you need to split it into two separate inequalities: x - 2 <= -3 and -x - 2 <= -3. Solving each inequality separately gives x <= -5 and x >= 5, respectively. Therefore, the complete solution is x <= -5

Determine the truth value of the following statements if the universe of discourse of each variable is the set of real numbers. Enter your answer as Tor F.
1.∃x∀y(xy = 0)
2. ∃x (x^2 = -1)

Answers

The truth value for the logical proposition is 1) T 2) F 3) T 4) F 5) T

The rules of mathematical logic specify methods of reasoning mathematical statements. Greek philosopher, Aristotle, was the pioneer of logical reasoning. Logical reasoning provides the theoretical base for many areas of mathematics and consequently computer science. It has many practical applications in computer science like the design of computing machines, artificial intelligence, the definition of data structures for programming languages etc.

Propositional Logic is concerned with statements to which the truth values, “true” and “false”, can be assigned. The purpose is to analyze these statements either individually or in a composite manner

the truth value of the following statements if the universe of discourse of each variable is the set of real numbers. Enter your answer as T or F.

1) there exists x for all y xy=0  is true     T

2) there exist x x2=-1                               F

3) for all x2=y                                           T

4) for all x there exist  x=y2                     F

5) for all x not equal to zero xy=1           T                            

The complete question is -

the truth value of the following statements if the universe of discourse of each variable is the set of real numbers. Enter your answer as T or F.

1) there exists x for all y xy=0  is true    

2) there exist x x2=-1                              

3) for all x2=y                                          

4) for all x there exist  x=y2                    

5) for all x not equal to zero xy=1      

learn more about  truth value ,

https://brainly.com/question/18994288

#SPJ4              

Leager
Assessment Items
Question
A researcher found that for the years 2013 to 2019, the equation, y=-0.4(2-3)² + 42,
models the average gas mileage of new vehicles sold in Switzerland, where z is the
number of years since 2013 and y is the average gas mileage, in miles per gallon (mpg).
During what year was the average gas mileage for new vehicles sold in Switzerland the
greatest?

Answers

2016 is the year in which the average gas mileage is the greatest.

What is an equation?

An equation contains one or more variables connected by an equal sign.

Example:

1x + 2 = 99 is an equation.

We have,

y = -0.4 (x - 3)² + 42

where x = the number of years since 2013.

y = average gas mileage

Now,

In 2016,

x = 3

y = -0.4 (3 - 3)² + 42

y = 0 + 42

y = 42

This is the greatest value for any x value.

Thus,

In 2016, the average gas mileage for new vehicles sold is the greatest.

Learn more about equations here:

https://brainly.com/question/17194269

#SPJ9

In fall​ 2006, Pace University in New York raised its annual tuition from ​$25,000 to ​$29,750. Freshman enrollment declined from 1,475 in fall 2005 to 1,130 in fall 2006. Assuming that the demand curve for places in the freshmen class at Pace did not shift between 2005 and​ 2006, use this information to calculate the price elasticity of demand LOADING... . Use the midpoint formula in your calculation.

Answers

Answer:The answer is 20000

Step-by-step explanation:

Help!! Drag and drop a statement or reason to each box to complete the proof.

Given: PQ≅PR

Prove: ∠Q≅∠R

Answers

The triangles ΔPQM and ΔPRM are congruent. Then angle Q is identical to angle R.

What is the triangle?

The polygonal shape of a triangle has a number of sides and three independent variables. Angles in the triangle add up to 180°.

The line segment PM is the median of the isosceles triangle ΔPQR.

Point M is the midpoint of QR by the definition of the median.

In triangles ΔPQM and ΔPRM, then we have

PQ = PR                   {Given}

QM = RM                 {Mid point}

MP = MP                  {Reflexive property}

The triangles ΔPQM and ΔPRM are congruent to each other by SSS postulates.

∠Q = ∠R

More about the triangle link is given below.

https://brainly.com/question/25813512

#SPJ1

The complete question is given below.

The line segment PM is the median of the isosceles triangle ΔPQR. Drag and drop a statement or reason to each box to complete the proof.

Given: PQ ≅ PR

Prove: ∠Q ≅ ∠R

Other Questions
Bodmas sums 2.4of4.5-5.6/1.4+3.8*2 Select the correct definition of the standard error of the sample mean from the choices below. The standard error of the sample mean is Select O the standard deviation of the means of randomly drawn samples from the population. O the range of values above and belowO The sample statistic in a confidence interval. O the random and systematic errors that occur during data collection and analysis. O the probability distribution of the sample means. O rejecting the null hypothesis when it is true. who is credited with spreading cristianity through the roman empire Place in order the steps involved for flavors on the tongue to create a perception in the brain.-Chemical substances in food disolve in saliva.-Taste receptors are stimulated.-Signals are sent to the thalamus.-The frontal lobe perceives taste. a drawer contains 6 red so cks, 4 green so cks, and 2 black so cks. two so cks are chosen at random. what is the probability that they match? what is the least common denominator for 5/8, 7/20, and 7/13 What building that is designed and equipped with machinery for manufacturing textile products ? Which state joined the union in 1810 as a slave state?MaineMissouriLouisianaWest Virginia How does the body maintain thermoregulation? Martha has a box of assorted chips. There are 2 bags of Doritos, 4 bags of Cheetos, and 5 bags of plainpotato chips.a. What is the probabilty that Martha will grab a bag of potato chips? Write your answer as an unreducedfraction & a percent.b. If Martha grabs a bag of potato chips and takes them to eat with her lunch, what is the probability that herfriend, Jamie, will grab a bag of potato chips out of the box next? Write your answer as an unreduced fraction& a percent.c. Is this an independent or dependent event? EXPLAIN. what kinds of plants will we find in coastal wetlands Which element of a personal narrative would be best for Spencer to include nexrt? Mr. Powell manages a department store and needs an easy way to look up products on thecomputer. He wants to assign each product in his department a unique code that will be the sanumber of letters long and use only the letters A, B, and C in the code. How many letters longeach code need to be so that Mr. Powell can account for all 1, 510 products?O 120607O 504 Two different investment companies offer college savings plans, one at 8.4% compounded continuously and the other at 8.6% compounded quarterly. Which is the better investment? 6. how many grams of water are needed to dissolve 25.31 g of potassium nitrate (kno3, mw 101.11 g/mol) in order to prepare a 0.1982 m solution? Help me with this question What is the meaning of "diplomatic initiative"? Which type of switch connects all devices in a rack to the rest of the network?choose the answer: a. ToR switch b. Spine switch c. EoR switch d. Core switch Use the Punnett square to determine the ratio of offspring with: Brown body and red eyes : Brown body and brown eyes : Black body and red eyes : Black body and brown eyes : Which type of bias involves becoming fixated on a single trait of a problem?A) anchoring biasB) confirmation biasC) representative biasD) availability bias